C14H12ClN5O2S2 — CID 87441398
[5-[(2-chloro-4-pyridinyl)amino]-2-methyl-1,3-thiazol-4-yl] N-(2-methyl-1,3-thiazol-4-yl)carbamate (PubChem CID 87441398) has the molecular formula C14H12ClN5O2S2 and a molecular weight of 381.87 g/mol. Its IUPAC name is [5-[(2-chloro-4-pyridinyl)amino]-2-methyl-1,3-thiazol-4-yl] N-(2-methyl-1,3-thiazol-4-yl)carbamate.
| Compound Name | [5-[(2-chloro-4-pyridinyl)amino]-2-methyl-1,3-thiazol-4-yl] N-(2-methyl-1,3-thiazol-4-yl)carbamate |
|---|---|
| PubChem CID | 87441398 |
| Molecular Formula | C14H12ClN5O2S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | [5-[(2-chloro-4-pyridinyl)amino]-2-methyl-1,3-thiazol-4-yl] N-(2-methyl-1,3-thiazol-4-yl)carbamate |
| SMILES | Cc1nc(NC(=O)Oc2nc(C)sc2Nc2ccnc(Cl)c2)cs1 |
| InChI | InChI=1S/C14H12ClN5O2S2/c1-7-17-11(6-23-7)20-14(21)22-12-13(24-8(2)18-12)19-9-3-4-16-10(15)5-9/h3-6H,1-2H3,(H,16,19)(H,20,21) |
| InChIKey | DPLBPSZUIYXNOK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|