C13H15N3O — CID 115233774
3-(5-amino-2-oxo-3H-indol-1-yl)-2,2-dimethylpropanenitrile (PubChem CID 115233774) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(5-amino-2-oxo-3H-indol-1-yl)-2,2-dimethylpropanenitrile.
| Compound Name | 3-(5-amino-2-oxo-3H-indol-1-yl)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 115233774 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-(5-amino-2-oxo-3H-indol-1-yl)-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)CN1C(=O)Cc2cc(N)ccc21 |
| InChI | InChI=1S/C13H15N3O/c1-13(2,7-14)8-16-11-4-3-10(15)5-9(11)6-12(16)17/h3-5H,6,8,15H2,1-2H3 |
| InChIKey | NFMHMHBKGFFXMH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|