(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid

C14H19NO2 — CID 115237061

IUPAC(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid
SMILESCc1ccc(N(C)C/C=C/C(=O)O)c(C)c1C
InChIInChI=1S/C14H19NO2/c1-10-7-8-13(12(3)11(10)2)15(4)9-5-6-14(16)17/h5-8H,9H2,1-4H3,(H,16,17)/b6-5+
InChIKeyNMNQUCKHYRMLTR-AATRIKPKSA-N
MW233.31 g/mol
LogP2.69
Rot. Bonds4

About (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid

(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid (PubChem CID 115237061) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid
PubChem CID115237061
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid
SMILESCc1ccc(N(C)C/C=C/C(=O)O)c(C)c1C
InChIInChI=1S/C14H19NO2/c1-10-7-8-13(12(3)11(10)2)15(4)9-5-6-14(16)17/h5-8H,9H2,1-4H3,(H,16,17)/b6-5+
InChIKeyNMNQUCKHYRMLTR-AATRIKPKSA-N
XLogP2.69
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid?
The IUPAC name of (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid (CID 115237061) is (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid.
What is the SMILES notation for (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid?
The canonical SMILES for (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid is Cc1ccc(N(C)C/C=C/C(=O)O)c(C)c1C.
What is the InChIKey of (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid?
The InChIKey is NMNQUCKHYRMLTR-AATRIKPKSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10-7-8-13(12(3)11(10)2)15(4)9-5-6-14(16)17/h5-8H,9H2,1-4H3,(H,16,17)/b6-5+.
What are the key properties of (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid?
(E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid has a molecular weight of 233.31 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(N,2,3,4-tetramethylanilino)but-2-enoic acid is sourced from PubChem (CID 115237061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).