C12H17NO2 — CID 57360531
ethyl-(2,3,4-trimethylphenyl)carbamic acid (PubChem CID 57360531) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is ethyl-(2,3,4-trimethylphenyl)carbamic acid.
| Compound Name | ethyl-(2,3,4-trimethylphenyl)carbamic acid |
|---|---|
| PubChem CID | 57360531 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | ethyl-(2,3,4-trimethylphenyl)carbamic acid |
| SMILES | CCN(C(=O)O)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C12H17NO2/c1-5-13(12(14)15)11-7-6-8(2)9(3)10(11)4/h6-7H,5H2,1-4H3,(H,14,15) |
| InChIKey | XEIDBDGDIGFZNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |