C18H20N4O5 — CID 57268537
ethyl-[2-methyl-3-[(2-methyl-3-nitrophenyl)carbamoylamino]phenyl]carbamic acid (PubChem CID 57268537) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is ethyl-[2-methyl-3-[(2-methyl-3-nitrophenyl)carbamoylamino]phenyl]carbamic acid.
| Compound Name | ethyl-[2-methyl-3-[(2-methyl-3-nitrophenyl)carbamoylamino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 57268537 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | ethyl-[2-methyl-3-[(2-methyl-3-nitrophenyl)carbamoylamino]phenyl]carbamic acid |
| SMILES | CCN(C(=O)O)c1cccc(NC(=O)Nc2cccc([N+](=O)[O-])c2C)c1C |
| InChI | InChI=1S/C18H20N4O5/c1-4-21(18(24)25)15-9-5-7-13(11(15)2)19-17(23)20-14-8-6-10-16(12(14)3)22(26)27/h5-10H,4H2,1-3H3,(H,24,25)(H2,19,20,23) |
| InChIKey | KDFDUPBUZZPSJJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|