C14H17F2NO2 — CID 115237407
(E)-4-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]but-2-enoic acid (PubChem CID 115237407) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is (E)-4-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]but-2-enoic acid.
| Compound Name | (E)-4-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 115237407 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (E)-4-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]but-2-enoic acid |
| SMILES | CC(C)(CNC/C=C/C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H17F2NO2/c1-14(2,9-17-7-3-4-13(18)19)11-6-5-10(15)8-12(11)16/h3-6,8,17H,7,9H2,1-2H3,(H,18,19)/b4-3+ |
| InChIKey | WUKWSVRWMQTGLX-ONEGZZNKSA-N |
| XLogP | 2.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|