C19H26F2N2O2 — CID 166932266
2-amino-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-2-(4-formylcyclohexyl)acetamide (PubChem CID 166932266) has the molecular formula C19H26F2N2O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-amino-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-2-(4-formylcyclohexyl)acetamide.
| Compound Name | 2-amino-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-2-(4-formylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 166932266 |
| Molecular Formula | C19H26F2N2O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-amino-N-[2-(2,4-difluorophenyl)-2-methylpropyl]-2-(4-formylcyclohexyl)acetamide |
| SMILES | CC(C)(CNC(=O)C(N)C1CCC(C=O)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H26F2N2O2/c1-19(2,15-8-7-14(20)9-16(15)21)11-23-18(25)17(22)13-5-3-12(10-24)4-6-13/h7-10,12-13,17H,3-6,11,22H2,1-2H3,(H,23,25) |
| InChIKey | PKOXRQMYCMLKHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|