C20H29F2N3O2 — CID 166932387
2-amino-N-[2-(3,4-difluorophenyl)-2-ethylbutyl]-2-(1-formylpiperidin-4-yl)acetamide (PubChem CID 166932387) has the molecular formula C20H29F2N3O2 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-amino-N-[2-(3,4-difluorophenyl)-2-ethylbutyl]-2-(1-formylpiperidin-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(3,4-difluorophenyl)-2-ethylbutyl]-2-(1-formylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 166932387 |
| Molecular Formula | C20H29F2N3O2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-amino-N-[2-(3,4-difluorophenyl)-2-ethylbutyl]-2-(1-formylpiperidin-4-yl)acetamide |
| SMILES | CCC(CC)(CNC(=O)C(N)C1CCN(C=O)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H29F2N3O2/c1-3-20(4-2,15-5-6-16(21)17(22)11-15)12-24-19(27)18(23)14-7-9-25(13-26)10-8-14/h5-6,11,13-14,18H,3-4,7-10,12,23H2,1-2H3,(H,24,27) |
| InChIKey | MYYUWGRFXZGAJS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|