C15H30N2O2 — CID 120796618
2-amino-N-(2,2-diethylbutyl)-2-(oxan-4-yl)acetamide (PubChem CID 120796618) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethylbutyl)-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-(2,2-diethylbutyl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120796618 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-amino-N-(2,2-diethylbutyl)-2-(oxan-4-yl)acetamide |
| SMILES | CCC(CC)(CC)CNC(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C15H30N2O2/c1-4-15(5-2,6-3)11-17-14(18)13(16)12-7-9-19-10-8-12/h12-13H,4-11,16H2,1-3H3,(H,17,18) |
| InChIKey | TZWAKONTZJGWKJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |