C14H28N2O3 — CID 120793986
2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-(oxan-4-yl)acetamide (PubChem CID 120793986) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120793986 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-(oxan-4-yl)acetamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C14H28N2O3/c1-14(2,3)8-11(17)9-16-13(18)12(15)10-4-6-19-7-5-10/h10-12,17H,4-9,15H2,1-3H3,(H,16,18) |
| InChIKey | IELLKCSTFQFJOI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |