C13H24N2O4 — CID 120784836
propan-2-yl 3-[[2-amino-2-(oxan-4-yl)acetyl]amino]propanoate (PubChem CID 120784836) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is propan-2-yl 3-[[2-amino-2-(oxan-4-yl)acetyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[2-amino-2-(oxan-4-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 120784836 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | propan-2-yl 3-[[2-amino-2-(oxan-4-yl)acetyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C13H24N2O4/c1-9(2)19-11(16)3-6-15-13(17)12(14)10-4-7-18-8-5-10/h9-10,12H,3-8,14H2,1-2H3,(H,15,17) |
| InChIKey | DWLFTHIHOFGZBV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |