C13H29Cl2N3O3 — CID 120799495
2-amino-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride (PubChem CID 120799495) has the molecular formula C13H29Cl2N3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-amino-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120799495 |
| Molecular Formula | C13H29Cl2N3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-amino-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
| SMILES | COCCN(C)CCNC(=O)C(N)C1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C13H27N3O3.2ClH/c1-16(7-10-18-2)6-5-15-13(17)12(14)11-3-8-19-9-4-11;;/h11-12H,3-10,14H2,1-2H3,(H,15,17);2*1H |
| InChIKey | JGNRETRZFLOYTF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |