C9H19N3O2 — CID 116849875
2-amino-N',N'-dimethyl-2-(oxan-4-yl)acetohydrazide (PubChem CID 116849875) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-amino-N',N'-dimethyl-2-(oxan-4-yl)acetohydrazide.
| Compound Name | 2-amino-N',N'-dimethyl-2-(oxan-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 116849875 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-amino-N',N'-dimethyl-2-(oxan-4-yl)acetohydrazide |
| SMILES | CN(C)NC(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C9H19N3O2/c1-12(2)11-9(13)8(10)7-3-5-14-6-4-7/h7-8H,3-6,10H2,1-2H3,(H,11,13) |
| InChIKey | DJAHRBNGJFAEML-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|