C14H27N3O4 — CID 120788034
2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-(oxan-4-yl)acetamide (PubChem CID 120788034) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120788034 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-(oxan-4-yl)acetamide |
| SMILES | COCCN(CC(=O)N(C)C)C(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C14H27N3O4/c1-16(2)12(18)10-17(6-9-20-3)14(19)13(15)11-4-7-21-8-5-11/h11,13H,4-10,15H2,1-3H3 |
| InChIKey | NMHBRNBFMZTJBR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |