C12H25N3O3 — CID 79202084
N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methyl-3-(methylamino)propanamide (PubChem CID 79202084) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 79202084 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)N(CCOC)CC(=O)N(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-10(8-13-2)12(17)15(6-7-18-5)9-11(16)14(3)4/h10,13H,6-9H2,1-5H3 |
| InChIKey | DGHWXYCHALGNMI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |