C13H27N3O3 — CID 54871190
2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-3-methylpentanamide (PubChem CID 54871190) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-3-methylpentanamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 54871190 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)N(CCOC)CC(=O)N(C)C |
| InChI | InChI=1S/C13H27N3O3/c1-6-10(2)12(14)13(18)16(7-8-19-5)9-11(17)15(3)4/h10,12H,6-9,14H2,1-5H3 |
| InChIKey | BCZVCAOMFRJRPB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |