C10H22N2O2 — CID 79202132
N-(3-methoxypropyl)-N,2-dimethyl-3-(methylamino)propanamide (PubChem CID 79202132) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N,2-dimethyl-3-(methylamino)propanamide.
| Compound Name | N-(3-methoxypropyl)-N,2-dimethyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 79202132 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N-(3-methoxypropyl)-N,2-dimethyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)N(C)CCCOC |
| InChI | InChI=1S/C10H22N2O2/c1-9(8-11-2)10(13)12(3)6-5-7-14-4/h9,11H,5-8H2,1-4H3 |
| InChIKey | GMWGFCXCQWNBCP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|