C10H20N2O2 — CID 116850358
3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide (PubChem CID 116850358) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide.
| Compound Name | 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 116850358 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide |
| SMILES | CN(C)C(=O)CC(N)C1CCOCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-12(2)10(13)7-9(11)8-3-5-14-6-4-8/h8-9H,3-7,11H2,1-2H3 |
| InChIKey | OSOMBFIHOGJEDC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |