About 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide
3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide (PubChem CID 116850358) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide |
| PubChem CID | 116850358 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide |
| SMILES | CN(C)C(=O)CC(N)C1CCOCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-12(2)10(13)7-9(11)8-3-5-14-6-4-8/h8-9H,3-7,11H2,1-2H3 |
| InChIKey | OSOMBFIHOGJEDC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide?
The IUPAC name of 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide (CID 116850358) is 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide.
What is the SMILES notation for 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide?
The canonical SMILES for 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide is CN(C)C(=O)CC(N)C1CCOCC1.
What is the InChIKey of 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide?
The InChIKey is OSOMBFIHOGJEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-12(2)10(13)7-9(11)8-3-5-14-6-4-8/h8-9H,3-7,11H2,1-2H3.
What are the key properties of 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide?
3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide has a molecular weight of 200.28 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethyl-3-(oxan-4-yl)propanamide is sourced from PubChem (CID 116850358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).