C19H24ClFN2O2 — CID 166932189
2-amino-N-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-2-(4-formylcyclohexyl)acetamide (PubChem CID 166932189) has the molecular formula C19H24ClFN2O2 and a molecular weight of 366.86 g/mol. Its IUPAC name is 2-amino-N-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-2-(4-formylcyclohexyl)acetamide.
| Compound Name | 2-amino-N-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-2-(4-formylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 166932189 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-amino-N-[[1-(2-chloro-4-fluorophenyl)cyclopropyl]methyl]-2-(4-formylcyclohexyl)acetamide |
| SMILES | NC(C(=O)NCC1(c2ccc(F)cc2Cl)CC1)C1CCC(C=O)CC1 |
| InChI | InChI=1S/C19H24ClFN2O2/c20-16-9-14(21)5-6-15(16)19(7-8-19)11-23-18(25)17(22)13-3-1-12(10-24)2-4-13/h5-6,9-10,12-13,17H,1-4,7-8,11,22H2,(H,23,25) |
| InChIKey | HOALHTQMYOVXRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|