C15H31N3O — CID 115238229
2-methyl-2-(1-methylpiperidin-3-yl)-N-(morpholin-3-ylmethyl)propan-1-amine (PubChem CID 115238229) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-methyl-2-(1-methylpiperidin-3-yl)-N-(morpholin-3-ylmethyl)propan-1-amine.
| Compound Name | 2-methyl-2-(1-methylpiperidin-3-yl)-N-(morpholin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115238229 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 2-methyl-2-(1-methylpiperidin-3-yl)-N-(morpholin-3-ylmethyl)propan-1-amine |
| SMILES | CN1CCCC(C(C)(C)CNCC2COCCN2)C1 |
| InChI | InChI=1S/C15H31N3O/c1-15(2,13-5-4-7-18(3)10-13)12-16-9-14-11-19-8-6-17-14/h13-14,16-17H,4-12H2,1-3H3 |
| InChIKey | NKWGCGHZNMPMKN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |