C16H27N3 — CID 115239412
N-[(2,4-dimethylphenyl)methyl]-2-(4-methylpiperazin-2-yl)ethanamine (PubChem CID 115239412) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2-(4-methylpiperazin-2-yl)ethanamine.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2-(4-methylpiperazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 115239412 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2-(4-methylpiperazin-2-yl)ethanamine |
| SMILES | Cc1ccc(CNCCC2CN(C)CCN2)c(C)c1 |
| InChI | InChI=1S/C16H27N3/c1-13-4-5-15(14(2)10-13)11-17-7-6-16-12-19(3)9-8-18-16/h4-5,10,16-18H,6-9,11-12H2,1-3H3 |
| InChIKey | JNSCNYKBZXKSEY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|