C16H26N2 — CID 115211094
N-[(2,4-dimethylphenyl)methyl]-2-piperidin-2-ylethanamine (PubChem CID 115211094) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2-piperidin-2-ylethanamine.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2-piperidin-2-ylethanamine |
|---|---|
| PubChem CID | 115211094 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2-piperidin-2-ylethanamine |
| SMILES | Cc1ccc(CNCCC2CCCCN2)c(C)c1 |
| InChI | InChI=1S/C16H26N2/c1-13-6-7-15(14(2)11-13)12-17-10-8-16-5-3-4-9-18-16/h6-7,11,16-18H,3-5,8-10,12H2,1-2H3 |
| InChIKey | BPHZLIWZNFWQQS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|