C21H28F2N2 — CID 143196331
N-benzyl-2-piperidin-2-ylethanamine;1,3-difluoro-5-methylbenzene (PubChem CID 143196331) has the molecular formula C21H28F2N2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-benzyl-2-piperidin-2-ylethanamine;1,3-difluoro-5-methylbenzene.
| Compound Name | N-benzyl-2-piperidin-2-ylethanamine;1,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 143196331 |
| Molecular Formula | C21H28F2N2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | N-benzyl-2-piperidin-2-ylethanamine;1,3-difluoro-5-methylbenzene |
| SMILES | Cc1cc(F)cc(F)c1.c1ccc(CNCCC2CCCCN2)cc1 |
| InChI | InChI=1S/C14H22N2.C7H6F2/c1-2-6-13(7-3-1)12-15-11-9-14-8-4-5-10-16-14;1-5-2-6(8)4-7(9)3-5/h1-3,6-7,14-16H,4-5,8-12H2;2-4H,1H3 |
| InChIKey | VYXOQLGVGHIRIF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|