C16H23NO2 — CID 115240070
4-[(4-methoxy-N,3-dimethylanilino)methyl]cyclohexan-1-one (PubChem CID 115240070) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[(4-methoxy-N,3-dimethylanilino)methyl]cyclohexan-1-one.
| Compound Name | 4-[(4-methoxy-N,3-dimethylanilino)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 115240070 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-[(4-methoxy-N,3-dimethylanilino)methyl]cyclohexan-1-one |
| SMILES | COc1ccc(N(C)CC2CCC(=O)CC2)cc1C |
| InChI | InChI=1S/C16H23NO2/c1-12-10-14(6-9-16(12)19-3)17(2)11-13-4-7-15(18)8-5-13/h6,9-10,13H,4-5,7-8,11H2,1-3H3 |
| InChIKey | QSSXGKLTJRAGJS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|