C13H14N4 — CID 115242005
1-[[(2-methyl-3H-benzimidazol-5-yl)amino]methyl]cyclopropane-1-carbonitrile (PubChem CID 115242005) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-[[(2-methyl-3H-benzimidazol-5-yl)amino]methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[[(2-methyl-3H-benzimidazol-5-yl)amino]methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 115242005 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[[(2-methyl-3H-benzimidazol-5-yl)amino]methyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1nc2ccc(NCC3(C#N)CC3)cc2[nH]1 |
| InChI | InChI=1S/C13H14N4/c1-9-16-11-3-2-10(6-12(11)17-9)15-8-13(7-14)4-5-13/h2-3,6,15H,4-5,8H2,1H3,(H,16,17) |
| InChIKey | HJEJENTVFCMNPB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |