C9H12N4 — CID 170206143
1-methyl-2-(2-methyl-3H-benzimidazol-5-yl)hydrazine (PubChem CID 170206143) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-3H-benzimidazol-5-yl)hydrazine.
| Compound Name | 1-methyl-2-(2-methyl-3H-benzimidazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 170206143 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-methyl-2-(2-methyl-3H-benzimidazol-5-yl)hydrazine |
| SMILES | CNNc1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C9H12N4/c1-6-11-8-4-3-7(13-10-2)5-9(8)12-6/h3-5,10,13H,1-2H3,(H,11,12) |
| InChIKey | FQLHFKTYVINIQY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|