C9H10BrN3O2S — CID 83084672
1-bromo-N-(2-methyl-3H-benzimidazol-5-yl)methanesulfonamide (PubChem CID 83084672) has the molecular formula C9H10BrN3O2S and a molecular weight of 304.17 g/mol. Its IUPAC name is 1-bromo-N-(2-methyl-3H-benzimidazol-5-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2-methyl-3H-benzimidazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 83084672 |
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 1-bromo-N-(2-methyl-3H-benzimidazol-5-yl)methanesulfonamide |
| SMILES | Cc1nc2ccc(NS(=O)(=O)CBr)cc2[nH]1 |
| InChI | InChI=1S/C9H10BrN3O2S/c1-6-11-8-3-2-7(4-9(8)12-6)13-16(14,15)5-10/h2-4,13H,5H2,1H3,(H,11,12) |
| InChIKey | BGSMHMUZKXLTNA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|