C11H14N2S — CID 115242191
1-[[methyl-(3-methylthiophen-2-yl)amino]methyl]cyclopropane-1-carbonitrile (PubChem CID 115242191) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-[[methyl-(3-methylthiophen-2-yl)amino]methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[[methyl-(3-methylthiophen-2-yl)amino]methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 115242191 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-[[methyl-(3-methylthiophen-2-yl)amino]methyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1ccsc1N(C)CC1(C#N)CC1 |
| InChI | InChI=1S/C11H14N2S/c1-9-3-6-14-10(9)13(2)8-11(7-12)4-5-11/h3,6H,4-5,8H2,1-2H3 |
| InChIKey | GMSHMGDAZYWUSO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |