C17H28N2 — CID 115245575
N-[[1-(aminomethyl)cyclobutyl]methyl]-5-tert-butyl-2-methylaniline (PubChem CID 115245575) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclobutyl]methyl]-5-tert-butyl-2-methylaniline.
| Compound Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-5-tert-butyl-2-methylaniline |
|---|---|
| PubChem CID | 115245575 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-5-tert-butyl-2-methylaniline |
| SMILES | Cc1ccc(C(C)(C)C)cc1NCC1(CN)CCC1 |
| InChI | InChI=1S/C17H28N2/c1-13-6-7-14(16(2,3)4)10-15(13)19-12-17(11-18)8-5-9-17/h6-7,10,19H,5,8-9,11-12,18H2,1-4H3 |
| InChIKey | SZOZNMBYRNZWBE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |