C14H21BrN2 — CID 115246072
5-bromo-2-methyl-N-[[1-(methylaminomethyl)cyclobutyl]methyl]aniline (PubChem CID 115246072) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[[1-(methylaminomethyl)cyclobutyl]methyl]aniline.
| Compound Name | 5-bromo-2-methyl-N-[[1-(methylaminomethyl)cyclobutyl]methyl]aniline |
|---|---|
| PubChem CID | 115246072 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-bromo-2-methyl-N-[[1-(methylaminomethyl)cyclobutyl]methyl]aniline |
| SMILES | CNCC1(CNc2cc(Br)ccc2C)CCC1 |
| InChI | InChI=1S/C14H21BrN2/c1-11-4-5-12(15)8-13(11)17-10-14(9-16-2)6-3-7-14/h4-5,8,16-17H,3,6-7,9-10H2,1-2H3 |
| InChIKey | BVVDUNJTADLPFH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |