C11H17BrN2S — CID 115246053
4-bromo-N-[[1-(methylaminomethyl)cyclobutyl]methyl]thiophen-2-amine (PubChem CID 115246053) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-bromo-N-[[1-(methylaminomethyl)cyclobutyl]methyl]thiophen-2-amine.
| Compound Name | 4-bromo-N-[[1-(methylaminomethyl)cyclobutyl]methyl]thiophen-2-amine |
|---|---|
| PubChem CID | 115246053 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 4-bromo-N-[[1-(methylaminomethyl)cyclobutyl]methyl]thiophen-2-amine |
| SMILES | CNCC1(CNc2cc(Br)cs2)CCC1 |
| InChI | InChI=1S/C11H17BrN2S/c1-13-7-11(3-2-4-11)8-14-10-5-9(12)6-15-10/h5-6,13-14H,2-4,7-8H2,1H3 |
| InChIKey | VFRSNENVWGJQAS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |