C11H15BrN2 — CID 115256437
N-[(1-aminocyclopropyl)methyl]-5-bromo-2-methylaniline (PubChem CID 115256437) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is N-[(1-aminocyclopropyl)methyl]-5-bromo-2-methylaniline.
| Compound Name | N-[(1-aminocyclopropyl)methyl]-5-bromo-2-methylaniline |
|---|---|
| PubChem CID | 115256437 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | N-[(1-aminocyclopropyl)methyl]-5-bromo-2-methylaniline |
| SMILES | Cc1ccc(Br)cc1NCC1(N)CC1 |
| InChI | InChI=1S/C11H15BrN2/c1-8-2-3-9(12)6-10(8)14-7-11(13)4-5-11/h2-3,6,14H,4-5,7,13H2,1H3 |
| InChIKey | OPESRKLOWRTPBH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |