C12H16N2O2 — CID 115247227
methyl 1-[(pyridin-4-ylamino)methyl]cyclobutane-1-carboxylate (PubChem CID 115247227) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 1-[(pyridin-4-ylamino)methyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[(pyridin-4-ylamino)methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 115247227 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | methyl 1-[(pyridin-4-ylamino)methyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(CNc2ccncc2)CCC1 |
| InChI | InChI=1S/C12H16N2O2/c1-16-11(15)12(5-2-6-12)9-14-10-3-7-13-8-4-10/h3-4,7-8H,2,5-6,9H2,1H3,(H,13,14) |
| InChIKey | OPWNEIUSGDLKMQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |