C11H14N2O2 — CID 115183955
1-(hydroxymethyl)-N-pyridin-4-ylcyclobutane-1-carboxamide (PubChem CID 115183955) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(hydroxymethyl)-N-pyridin-4-ylcyclobutane-1-carboxamide.
| Compound Name | 1-(hydroxymethyl)-N-pyridin-4-ylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183955 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(hydroxymethyl)-N-pyridin-4-ylcyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ccncc1)C1(CO)CCC1 |
| InChI | InChI=1S/C11H14N2O2/c14-8-11(4-1-5-11)10(15)13-9-2-6-12-7-3-9/h2-3,6-7,14H,1,4-5,8H2,(H,12,13,15) |
| InChIKey | JUJBQDWSRLDVSF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |