C11H16N4O — CID 139307147
4-amino-N-pyridin-4-ylpiperidine-4-carboxamide (PubChem CID 139307147) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-amino-N-pyridin-4-ylpiperidine-4-carboxamide.
| Compound Name | 4-amino-N-pyridin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 139307147 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-amino-N-pyridin-4-ylpiperidine-4-carboxamide |
| SMILES | NC1(C(=O)Nc2ccncc2)CCNCC1 |
| InChI | InChI=1S/C11H16N4O/c12-11(3-7-14-8-4-11)10(16)15-9-1-5-13-6-2-9/h1-2,5-6,14H,3-4,7-8,12H2,(H,13,15,16) |
| InChIKey | OYLYYAIXHAGHLV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |