2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid

C15H23NO3 — CID 115250182

IUPAC2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid
SMILESCOc1cc(C)c(C)cc1NCC(C(=O)O)C(C)C
InChIInChI=1S/C15H23NO3/c1-9(2)12(15(17)18)8-16-13-6-10(3)11(4)7-14(13)19-5/h6-7,9,12,16H,8H2,1-5H3,(H,17,18)
InChIKeyKSKPVTSHCLWRAX-UHFFFAOYSA-N
MW265.35 g/mol
LogP3.08
Rot. Bonds6

About 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid

2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid (PubChem CID 115250182) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid
PubChem CID115250182
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid
SMILESCOc1cc(C)c(C)cc1NCC(C(=O)O)C(C)C
InChIInChI=1S/C15H23NO3/c1-9(2)12(15(17)18)8-16-13-6-10(3)11(4)7-14(13)19-5/h6-7,9,12,16H,8H2,1-5H3,(H,17,18)
InChIKeyKSKPVTSHCLWRAX-UHFFFAOYSA-N
XLogP3.08
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 53.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid?
The IUPAC name of 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid (CID 115250182) is 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid.
What is the SMILES notation for 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid?
The canonical SMILES for 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid is COc1cc(C)c(C)cc1NCC(C(=O)O)C(C)C.
What is the InChIKey of 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid?
The InChIKey is KSKPVTSHCLWRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-9(2)12(15(17)18)8-16-13-6-10(3)11(4)7-14(13)19-5/h6-7,9,12,16H,8H2,1-5H3,(H,17,18).
What are the key properties of 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid?
2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid has a molecular weight of 265.35 g/mol, XLogP of 3.08, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methoxy-4,5-dimethylanilino)methyl]-3-methylbutanoic acid is sourced from PubChem (CID 115250182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).