C11H19N3 — CID 115251395
2-ethyl-N'-methyl-N'-pyridin-2-ylpropane-1,3-diamine (PubChem CID 115251395) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N'-pyridin-2-ylpropane-1,3-diamine.
| Compound Name | 2-ethyl-N'-methyl-N'-pyridin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115251395 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-ethyl-N'-methyl-N'-pyridin-2-ylpropane-1,3-diamine |
| SMILES | CCC(CN)CN(C)c1ccccn1 |
| InChI | InChI=1S/C11H19N3/c1-3-10(8-12)9-14(2)11-6-4-5-7-13-11/h4-7,10H,3,8-9,12H2,1-2H3 |
| InChIKey | JKOOGOBYCVHHRS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |