C25H26N2O4S — CID 11525241
ethyl (2R,3S)-3-cyano-4,4-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate (PubChem CID 11525241) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is ethyl (2R,3S)-3-cyano-4,4-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (2R,3S)-3-cyano-4,4-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11525241 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | ethyl (2R,3S)-3-cyano-4,4-bis(ethenyl)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate |
| SMILES | C=CC1(C=C)CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C25H26N2O4S/c1-5-24(6-2)18-27(32(29,30)21-15-13-19(4)14-16-21)22(20-11-9-8-10-12-20)25(24,17-26)23(28)31-7-3/h5-6,8-16,22H,1-2,7,18H2,3-4H3/t22-,25+/m1/s1 |
| InChIKey | NXVGKNYDZTWTHD-RDGATRHJSA-N |
| XLogP | 4.17 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|