C12H21BrN2S — CID 115252576
N'-[2-(4-bromothiophen-2-yl)ethyl]-2-propan-2-ylpropane-1,3-diamine (PubChem CID 115252576) has the molecular formula C12H21BrN2S and a molecular weight of 305.28 g/mol. Its IUPAC name is N'-[2-(4-bromothiophen-2-yl)ethyl]-2-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-[2-(4-bromothiophen-2-yl)ethyl]-2-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115252576 |
| Molecular Formula | C12H21BrN2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-[2-(4-bromothiophen-2-yl)ethyl]-2-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)C(CN)CNCCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H21BrN2S/c1-9(2)10(6-14)7-15-4-3-12-5-11(13)8-16-12/h5,8-10,15H,3-4,6-7,14H2,1-2H3 |
| InChIKey | MTFMAHZZFKXZHX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|