C10H17BrN2S — CID 115198009
N'-[2-(4-bromothiophen-2-yl)ethyl]-N-methylpropane-1,3-diamine (PubChem CID 115198009) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is N'-[2-(4-bromothiophen-2-yl)ethyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[2-(4-bromothiophen-2-yl)ethyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115198009 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | N'-[2-(4-bromothiophen-2-yl)ethyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H17BrN2S/c1-12-4-2-5-13-6-3-10-7-9(11)8-14-10/h7-8,12-13H,2-6H2,1H3 |
| InChIKey | HPRHHBOUOKZZGO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|