C13H17FN2 — CID 115253889
2-[[(4-fluorophenyl)methyl-methylamino]methyl]butanenitrile (PubChem CID 115253889) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)methyl-methylamino]methyl]butanenitrile.
| Compound Name | 2-[[(4-fluorophenyl)methyl-methylamino]methyl]butanenitrile |
|---|---|
| PubChem CID | 115253889 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-[[(4-fluorophenyl)methyl-methylamino]methyl]butanenitrile |
| SMILES | CCC(C#N)CN(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2/c1-3-11(8-15)9-16(2)10-12-4-6-13(14)7-5-12/h4-7,11H,3,9-10H2,1-2H3 |
| InChIKey | PRZGGCPUVXYUNY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |