C16H23BrN2 — CID 115254745
2-[[[2-(2-bromophenyl)-2-methylpropyl]amino]methyl]-3-methylbutanenitrile (PubChem CID 115254745) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-[[[2-(2-bromophenyl)-2-methylpropyl]amino]methyl]-3-methylbutanenitrile.
| Compound Name | 2-[[[2-(2-bromophenyl)-2-methylpropyl]amino]methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 115254745 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[[[2-(2-bromophenyl)-2-methylpropyl]amino]methyl]-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)CNCC(C)(C)c1ccccc1Br |
| InChI | InChI=1S/C16H23BrN2/c1-12(2)13(9-18)10-19-11-16(3,4)14-7-5-6-8-15(14)17/h5-8,12-13,19H,10-11H2,1-4H3 |
| InChIKey | CBOCHZVSFSYRIY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |