C13H16BrN — CID 54075785
3-(2-bromophenyl)-3,4-dimethylpentanenitrile (PubChem CID 54075785) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is 3-(2-bromophenyl)-3,4-dimethylpentanenitrile.
| Compound Name | 3-(2-bromophenyl)-3,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 54075785 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-(2-bromophenyl)-3,4-dimethylpentanenitrile |
| SMILES | CC(C)C(C)(CC#N)c1ccccc1Br |
| InChI | InChI=1S/C13H16BrN/c1-10(2)13(3,8-9-15)11-6-4-5-7-12(11)14/h4-7,10H,8H2,1-3H3 |
| InChIKey | MJONAJYUPPGZJI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |