C13H23N3S — CID 115255363
2-methyl-3-piperazin-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 115255363) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-methyl-3-piperazin-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 2-methyl-3-piperazin-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115255363 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-methyl-3-piperazin-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cccs1)CN1CCNCC1 |
| InChI | InChI=1S/C13H23N3S/c1-12(11-16-6-4-14-5-7-16)9-15-10-13-3-2-8-17-13/h2-3,8,12,14-15H,4-7,9-11H2,1H3 |
| InChIKey | OUXNEJNYJFNPLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |