C14H30N4 — CID 115255475
N,1-dimethyl-N-(3-piperazin-1-ylbutyl)pyrrolidin-3-amine (PubChem CID 115255475) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is N,1-dimethyl-N-(3-piperazin-1-ylbutyl)pyrrolidin-3-amine.
| Compound Name | N,1-dimethyl-N-(3-piperazin-1-ylbutyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115255475 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N,1-dimethyl-N-(3-piperazin-1-ylbutyl)pyrrolidin-3-amine |
| SMILES | CC(CCN(C)C1CCN(C)C1)N1CCNCC1 |
| InChI | InChI=1S/C14H30N4/c1-13(18-10-6-15-7-11-18)4-9-17(3)14-5-8-16(2)12-14/h13-15H,4-12H2,1-3H3 |
| InChIKey | VXBFUJVIJSGWCO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |