C15H24FN3 — CID 115255765
N-[2-(3-fluorophenyl)ethyl]-2-piperazin-1-ylpropan-1-amine (PubChem CID 115255765) has the molecular formula C15H24FN3 and a molecular weight of 265.38 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-2-piperazin-1-ylpropan-1-amine.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-2-piperazin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115255765 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-2-piperazin-1-ylpropan-1-amine |
| SMILES | CC(CNCCc1cccc(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C15H24FN3/c1-13(19-9-7-17-8-10-19)12-18-6-5-14-3-2-4-15(16)11-14/h2-4,11,13,17-18H,5-10,12H2,1H3 |
| InChIKey | VUWKWGDODITANG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|