C13H19F2N3 — CID 115255614
2,5-difluoro-N-(2-piperazin-1-ylpropyl)aniline (PubChem CID 115255614) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2,5-difluoro-N-(2-piperazin-1-ylpropyl)aniline.
| Compound Name | 2,5-difluoro-N-(2-piperazin-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 115255614 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2,5-difluoro-N-(2-piperazin-1-ylpropyl)aniline |
| SMILES | CC(CNc1cc(F)ccc1F)N1CCNCC1 |
| InChI | InChI=1S/C13H19F2N3/c1-10(18-6-4-16-5-7-18)9-17-13-8-11(14)2-3-12(13)15/h2-3,8,10,16-17H,4-7,9H2,1H3 |
| InChIKey | ACNDLZCPDBWBCH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |