C12H17FN2 — CID 115256614
1-[[(4-fluoro-3-methylphenyl)methylamino]methyl]cyclopropan-1-amine (PubChem CID 115256614) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-[[(4-fluoro-3-methylphenyl)methylamino]methyl]cyclopropan-1-amine.
| Compound Name | 1-[[(4-fluoro-3-methylphenyl)methylamino]methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 115256614 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[[(4-fluoro-3-methylphenyl)methylamino]methyl]cyclopropan-1-amine |
| SMILES | Cc1cc(CNCC2(N)CC2)ccc1F |
| InChI | InChI=1S/C12H17FN2/c1-9-6-10(2-3-11(9)13)7-15-8-12(14)4-5-12/h2-3,6,15H,4-5,7-8,14H2,1H3 |
| InChIKey | WGTIDVXFALFVJC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |