C19H12F6N4O5S — CID 1152611
2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]acetamide (PubChem CID 1152611) has the molecular formula C19H12F6N4O5S and a molecular weight of 522.38 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 1152611 |
| Molecular Formula | C19H12F6N4O5S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccco2)cc(C(F)(F)F)n1)Nc1cc(OCC(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12F6N4O5S/c20-18(21,22)9-34-12-5-10(4-11(6-12)29(31)32)26-16(30)8-35-17-27-13(14-2-1-3-33-14)7-15(28-17)19(23,24)25/h1-7H,8-9H2,(H,26,30) |
| InChIKey | PSDSXSFBNZETDV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|