C18H13F3N4O5S — CID 1152620
2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(3-methoxy-5-nitrophenyl)acetamide (PubChem CID 1152620) has the molecular formula C18H13F3N4O5S and a molecular weight of 454.39 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(3-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(3-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1152620 |
| Molecular Formula | C18H13F3N4O5S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(3-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2nc(-c3ccco3)cc(C(F)(F)F)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13F3N4O5S/c1-29-12-6-10(5-11(7-12)25(27)28)22-16(26)9-31-17-23-13(14-3-2-4-30-14)8-15(24-17)18(19,20)21/h2-8H,9H2,1H3,(H,22,26) |
| InChIKey | SAIJZMMTKXTFEB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|